![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | MSC024MOPMOL SPECTROSCOPY, II M SC CHE ,II,AUG15.pdf | 2021-12-07 11:16 | 176K | |
![[ ]](/icons/layout.gif) | MSC024MOP2016 AUGMolecular spectroscopy 2016 aUG.pdf | 2021-12-07 11:16 | 178K | |
![[ ]](/icons/layout.gif) | MSC023CBCSem3,AUG2014,Molecular spectroscopy.pdf | 2021-12-07 11:16 | 179K | |
![[ ]](/icons/layout.gif) | MSC024MOPSem3,AUG2014,Molecular spectroscopy.pdf | 2021-12-07 11:16 | 179K | |
![[ ]](/icons/layout.gif) | MSC023CBCCHEMICAL BONDING,M.SC CHE,II,2015.pdf | 2021-12-07 11:16 | 182K | |
![[ ]](/icons/layout.gif) | MSC021COCSem3,AUG2014,Co ordination chemistry.pdf | 2021-12-07 11:16 | 182K | |
![[ ]](/icons/layout.gif) | MSC023CBCSem2,AUG2013,Chemical bonding and computational chemistry.pdf | 2021-12-07 11:16 | 183K | |
![[ ]](/icons/layout.gif) | MSC023CBC2016 AUGcHEMICAL BONDING AND COMPUTATIONA CHEMISTRY 2016 AUG.pdf | 2021-12-07 11:16 | 184K | |
![[ ]](/icons/layout.gif) | MSC021COC2016 AUGCo ordination chemistry 2016 Aug.pdf | 2021-12-07 11:16 | 185K | |
![[ ]](/icons/layout.gif) | MSC021COCCO ORDINATION CHEMISTRY MSC CHE II,AUG15.pdf | 2021-12-07 11:16 | 188K | |
![[ ]](/icons/layout.gif) | MSC024MOPSem3,Aug2013,Molecular spectroscopy (1).pdf | 2021-12-07 11:16 | 196K | |
![[ ]](/icons/layout.gif) | MSC024MOPSem3,Aug2013,Molecular spectroscopy.pdf | 2021-12-07 11:16 | 196K | |
![[ ]](/icons/layout.gif) | MSC021COCSem2,AUG2013,Co-ordination chemistry.pdf | 2021-12-07 11:16 | 202K | |
![[ ]](/icons/layout.gif) | MSC023CBC 2017 JULY Chemical Bonding And Computational Chemistry.pdf | 2021-12-07 11:16 | 230K | |
![[ ]](/icons/layout.gif) | MSC022ORM 2017 JULY Organic reaction mechanism.pdf | 2021-12-07 11:16 | 240K | |
![[ ]](/icons/layout.gif) | MSC022ORMORG.REA.MECH., MSC CHE ,II AUG15.pdf | 2021-12-07 11:16 | 247K | |
![[ ]](/icons/layout.gif) | MSC022ORMSem3,AUG2014,Organic reaction mechanisms.pdf | 2021-12-07 11:16 | 262K | |
![[ ]](/icons/layout.gif) | MSC022ORMSem3,2013,Organic reaction mechanisms (1).pdf | 2021-12-07 11:16 | 263K | |
![[ ]](/icons/layout.gif) | MSC022ORMSem3,2013,Organic reaction mechanisms.pdf | 2021-12-07 11:16 | 263K | |
![[ ]](/icons/layout.gif) | MSC024MOP 2017 JULY molecular spectroscopy.pdf | 2021-12-07 11:16 | 310K | |
![[ ]](/icons/layout.gif) | MSC021COC 2017 JULY Co ordination chemistry.pdf | 2021-12-07 11:16 | 315K | |
![[ ]](/icons/layout.gif) | MSC022ORM2016 AUGOrganic reaction mechanism 2016 aUG.pdf | 2021-12-07 11:16 | 332K | |
|