![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[ ]](/icons/layout.gif) | MSC012SMOstructural and molecular organic.pdf | 2021-12-07 11:16 | 366K | |
![[ ]](/icons/layout.gif) | MSC012SMOSem1,FEB2014,Structural and molecular organic chemistry.pdf | 2021-12-07 11:16 | 353K | |
![[ ]](/icons/layout.gif) | MSC012SMO2016 FEBstructural and molecular chemistry.pdf | 2021-12-07 11:16 | 340K | |
![[ ]](/icons/layout.gif) | MSC012SMO 2017 MAR Structural and molecular organic chemistry.pdf | 2021-12-07 11:16 | 314K | |
![[ ]](/icons/layout.gif) | MSC012SMOSem1,MAR13,Structural and molecular organic chemistry.pdf | 2021-12-07 11:16 | 297K | |
![[ ]](/icons/layout.gif) | MSC014CST 2017 MAR Classical and statistical thermodynamics.pdf | 2021-12-07 11:16 | 276K | |
![[ ]](/icons/layout.gif) | MSC013QCG 2017 MAR Quantum Chemistry.pdf | 2021-12-07 11:16 | 266K | |
![[ ]](/icons/layout.gif) | MSC011OMN 2017 MAR Organometallics.pdf | 2021-12-07 11:16 | 257K | |
![[ ]](/icons/layout.gif) | MSC014CST2016 FEBclassical and thermodynamics feb16.pdf | 2021-12-07 11:16 | 253K | |
![[ ]](/icons/layout.gif) | MSC014CSTclassical and statistical thermodynamics.pdf | 2021-12-07 11:16 | 239K | |
![[ ]](/icons/layout.gif) | MSC014CSTSem1,MAR13,Classical and statistical thermodynamics.pdf | 2021-12-07 11:16 | 226K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,MAR13,Classical and statistical thermodynamics.pdf | 2021-12-07 11:16 | 226K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,MAR13,Classical and statistical thermodynamics (1).pdf | 2021-12-07 11:16 | 226K | |
![[ ]](/icons/layout.gif) | MSC011OMNorganometallics.pdf | 2021-12-07 11:16 | 221K | |
![[ ]](/icons/layout.gif) | MSC013QCGquantum chemistry.pdf | 2021-12-07 11:16 | 214K | |
![[ ]](/icons/layout.gif) | MSC011OMNSem1,MAR13,Organometallics and nuclear chemistry.pdf | 2021-12-07 11:16 | 211K | |
![[ ]](/icons/layout.gif) | MSC014CSTSem1,FEB2014,Classical and statistical thermodynamics.pdf | 2021-12-07 11:16 | 211K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,FEB2014,Classical and statistical thermodynamics.pdf | 2021-12-07 11:16 | 211K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,FEB2014,Classical and statistical thermodynamics (1).pdf | 2021-12-07 11:16 | 211K | |
![[ ]](/icons/layout.gif) | MSC011OMNSem1,FEB2014,Organometallics and nuclear chemistry.pdf | 2021-12-07 11:16 | 200K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,MAR13,Quantum chemistry and group theory.pdf | 2021-12-07 11:16 | 199K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,MAR13,Quantum chemistry and group theory (1).pdf | 2021-12-07 11:16 | 199K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,FEB2014,Quantum chemistry and group theory.pdf | 2021-12-07 11:16 | 194K | |
![[ ]](/icons/layout.gif) | MSC013QCGSem1,FEB2014,Quantum chemistry and group theory (1).pdf | 2021-12-07 11:16 | 194K | |
![[ ]](/icons/layout.gif) | MSC011OMN2016 FEBorganometallics and nuclear chemistry feb16.pdf | 2021-12-07 11:16 | 188K | |
![[ ]](/icons/layout.gif) | MSC013QCG2016 FEBquantum chemistry and group theory.pdf | 2021-12-07 11:16 | 182K | |
|